C21H29N3O2 — CID 10641942
tert-butyl (2S)-2-(1-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-4-yl)pyrrolidine-1-carboxylate (PubChem CID 10641942) has the molecular formula C21H29N3O2 and a molecular weight of 355.48 g/mol. Its IUPAC name is tert-butyl (2S)-2-(1-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-4-yl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-(1-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-4-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 10641942 |
| Molecular Formula | C21H29N3O2 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | tert-butyl (2S)-2-(1-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-4-yl)pyrrolidine-1-carboxylate |
| SMILES | CC1NCC([C@@H]2CCCN2C(=O)OC(C)(C)C)c2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C21H29N3O2/c1-13-19-18(14-8-5-6-9-16(14)23-19)15(12-22-13)17-10-7-11-24(17)20(25)26-21(2,3)4/h5-6,8-9,13,15,17,22-23H,7,10-12H2,1-4H3/t13?,15?,17-/m0/s1 |
| InChIKey | LWQCDAXSIQRGIA-PGEKIEPBSA-N |
| XLogP | 4.32 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|