About tert-butyl (2R,3S)-3-hydroxy-2-methylpiperidine-1-carboxylate
tert-butyl (2R,3S)-3-hydroxy-2-methylpiperidine-1-carboxylate (PubChem CID 11148613) has the molecular formula C11H21NO3
and a molecular weight of 215.29 g/mol. Its IUPAC name is tert-butyl (2R,3S)-3-hydroxy-2-methylpiperidine-1-carboxylate.
Analyze tert-butyl (2R,3S)-3-hydroxy-2-methylpiperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2R,3S)-3-hydroxy-2-methylpiperidine-1-carboxylate?
The IUPAC name of tert-butyl (2R,3S)-3-hydroxy-2-methylpiperidine-1-carboxylate (CID 11148613) is tert-butyl (2R,3S)-3-hydroxy-2-methylpiperidine-1-carboxylate.
What is the SMILES notation for tert-butyl (2R,3S)-3-hydroxy-2-methylpiperidine-1-carboxylate?
The canonical SMILES for tert-butyl (2R,3S)-3-hydroxy-2-methylpiperidine-1-carboxylate is C[C@@H]1[C@@H](O)CCCN1C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl (2R,3S)-3-hydroxy-2-methylpiperidine-1-carboxylate?
The InChIKey is ADVNLLSPFSWKPK-BDAKNGLRSA-N. The full InChI is InChI=1S/C11H21NO3/c1-8-9(13)6-5-7-12(8)10(14)15-11(2,3)4/h8-9,13H,5-7H2,1-4H3/t8-,9+/m1/s1.
What are the key properties of tert-butyl (2R,3S)-3-hydroxy-2-methylpiperidine-1-carboxylate?
tert-butyl (2R,3S)-3-hydroxy-2-methylpiperidine-1-carboxylate has a molecular weight of 215.29 g/mol, XLogP of 1.77, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2R,3S)-3-hydroxy-2-methylpiperidine-1-carboxylate is sourced from PubChem (CID 11148613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).