C13H22N2O3 — CID 83671533
tert-butyl 5-oxo-2,3,4,4a,6,7,8,8a-octahydro-1,7-naphthyridine-1-carboxylate (PubChem CID 83671533) has the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. Its IUPAC name is tert-butyl 5-oxo-2,3,4,4a,6,7,8,8a-octahydro-1,7-naphthyridine-1-carboxylate.
| Compound Name | tert-butyl 5-oxo-2,3,4,4a,6,7,8,8a-octahydro-1,7-naphthyridine-1-carboxylate |
|---|---|
| PubChem CID | 83671533 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | tert-butyl 5-oxo-2,3,4,4a,6,7,8,8a-octahydro-1,7-naphthyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC2C(=O)CNCC21 |
| InChI | InChI=1S/C13H22N2O3/c1-13(2,3)18-12(17)15-6-4-5-9-10(15)7-14-8-11(9)16/h9-10,14H,4-8H2,1-3H3 |
| InChIKey | VLTLQJYXXWQCIV-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |