C26H35ClN4O4 — CID 139446375
tert-butyl 4-[(1S,3R)-2-(2-chloroacetyl)-3-(dimethylcarbamoyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]piperidine-1-carboxylate (PubChem CID 139446375) has the molecular formula C26H35ClN4O4 and a molecular weight of 503.04 g/mol. Its IUPAC name is tert-butyl 4-[(1S,3R)-2-(2-chloroacetyl)-3-(dimethylcarbamoyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(1S,3R)-2-(2-chloroacetyl)-3-(dimethylcarbamoyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 139446375 |
| Molecular Formula | C26H35ClN4O4 |
| Molecular Weight | 503.04 g/mol |
| Exact Mass | 502.23 |
| IUPAC Name | tert-butyl 4-[(1S,3R)-2-(2-chloroacetyl)-3-(dimethylcarbamoyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]piperidine-1-carboxylate |
| SMILES | CN(C)C(=O)[C@H]1Cc2c([nH]c3ccccc23)[C@H](C2CCN(C(=O)OC(C)(C)C)CC2)N1C(=O)CCl |
| InChI | InChI=1S/C26H35ClN4O4/c1-26(2,3)35-25(34)30-12-10-16(11-13-30)23-22-18(17-8-6-7-9-19(17)28-22)14-20(24(33)29(4)5)31(23)21(32)15-27/h6-9,16,20,23,28H,10-15H2,1-5H3/t20-,23+/m1/s1 |
| InChIKey | OWJDMEVVRXTUTG-OFNKIYASSA-N |
| XLogP | 3.94 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.04 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|