C16H17ClN2O — CID 10803333
1-[(3aS,10aS)-3,3a,4,9,10,10a-hexahydro-2H-pyrrolo[2,3-b]carbazol-1-yl]-2-chloroethanone (PubChem CID 10803333) has the molecular formula C16H17ClN2O and a molecular weight of 288.78 g/mol. Its IUPAC name is 1-[(3aS,10aS)-3,3a,4,9,10,10a-hexahydro-2H-pyrrolo[2,3-b]carbazol-1-yl]-2-chloroethanone.
| Compound Name | 1-[(3aS,10aS)-3,3a,4,9,10,10a-hexahydro-2H-pyrrolo[2,3-b]carbazol-1-yl]-2-chloroethanone |
|---|---|
| PubChem CID | 10803333 |
| Molecular Formula | C16H17ClN2O |
| Molecular Weight | 288.78 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 1-[(3aS,10aS)-3,3a,4,9,10,10a-hexahydro-2H-pyrrolo[2,3-b]carbazol-1-yl]-2-chloroethanone |
| SMILES | O=C(CCl)N1CC[C@@H]2Cc3c([nH]c4ccccc34)C[C@@H]21 |
| InChI | InChI=1S/C16H17ClN2O/c17-9-16(20)19-6-5-10-7-12-11-3-1-2-4-13(11)18-14(12)8-15(10)19/h1-4,10,15,18H,5-9H2/t10-,15+/m1/s1 |
| InChIKey | RYPHCYQHNTXMLJ-BMIGLBTASA-N |
| XLogP | 2.72 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.78 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|