C25H25Cl2N3O2 — CID 143675053
3,4-dichloro-N-[2-oxo-2-[3-(2,3,4,9-tetrahydro-1H-carbazol-2-yl)pyrrolidin-1-yl]ethyl]benzamide (PubChem CID 143675053) has the molecular formula C25H25Cl2N3O2 and a molecular weight of 470.40 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-oxo-2-[3-(2,3,4,9-tetrahydro-1H-carbazol-2-yl)pyrrolidin-1-yl]ethyl]benzamide.
| Compound Name | 3,4-dichloro-N-[2-oxo-2-[3-(2,3,4,9-tetrahydro-1H-carbazol-2-yl)pyrrolidin-1-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 143675053 |
| Molecular Formula | C25H25Cl2N3O2 |
| Molecular Weight | 470.40 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | 3,4-dichloro-N-[2-oxo-2-[3-(2,3,4,9-tetrahydro-1H-carbazol-2-yl)pyrrolidin-1-yl]ethyl]benzamide |
| SMILES | O=C(NCC(=O)N1CCC(C2CCc3c([nH]c4ccccc34)C2)C1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C25H25Cl2N3O2/c26-20-8-6-16(11-21(20)27)25(32)28-13-24(31)30-10-9-17(14-30)15-5-7-19-18-3-1-2-4-22(18)29-23(19)12-15/h1-4,6,8,11,15,17,29H,5,7,9-10,12-14H2,(H,28,32) |
| InChIKey | HYRTYRXWKCSLLD-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.40 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|