C17H20N2O — CID 113203529
pyrrolidin-1-yl(2,3,4,9-tetrahydro-1H-carbazol-3-yl)methanone (PubChem CID 113203529) has the molecular formula C17H20N2O and a molecular weight of 268.36 g/mol. Its IUPAC name is pyrrolidin-1-yl(2,3,4,9-tetrahydro-1H-carbazol-3-yl)methanone.
| Compound Name | pyrrolidin-1-yl(2,3,4,9-tetrahydro-1H-carbazol-3-yl)methanone |
|---|---|
| PubChem CID | 113203529 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | pyrrolidin-1-yl(2,3,4,9-tetrahydro-1H-carbazol-3-yl)methanone |
| SMILES | O=C(C1CCc2[nH]c3ccccc3c2C1)N1CCCC1 |
| InChI | InChI=1S/C17H20N2O/c20-17(19-9-3-4-10-19)12-7-8-16-14(11-12)13-5-1-2-6-15(13)18-16/h1-2,5-6,12,18H,3-4,7-11H2 |
| InChIKey | IJMBPLJOAVJHDQ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|