C23H24FN3O — CID 113203576
[4-(4-fluorophenyl)piperazin-1-yl]-(2,3,4,9-tetrahydro-1H-carbazol-3-yl)methanone (PubChem CID 113203576) has the molecular formula C23H24FN3O and a molecular weight of 377.46 g/mol. Its IUPAC name is [4-(4-fluorophenyl)piperazin-1-yl]-(2,3,4,9-tetrahydro-1H-carbazol-3-yl)methanone.
| Compound Name | [4-(4-fluorophenyl)piperazin-1-yl]-(2,3,4,9-tetrahydro-1H-carbazol-3-yl)methanone |
|---|---|
| PubChem CID | 113203576 |
| Molecular Formula | C23H24FN3O |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | [4-(4-fluorophenyl)piperazin-1-yl]-(2,3,4,9-tetrahydro-1H-carbazol-3-yl)methanone |
| SMILES | O=C(C1CCc2[nH]c3ccccc3c2C1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C23H24FN3O/c24-17-6-8-18(9-7-17)26-11-13-27(14-12-26)23(28)16-5-10-22-20(15-16)19-3-1-2-4-21(19)25-22/h1-4,6-9,16,25H,5,10-15H2 |
| InChIKey | LKDTUIJYXLJNFW-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|