C21H23N5O — CID 113203593
(4-pyrimidin-2-ylpiperazin-1-yl)-(2,3,4,9-tetrahydro-1H-carbazol-3-yl)methanone (PubChem CID 113203593) has the molecular formula C21H23N5O and a molecular weight of 361.45 g/mol. Its IUPAC name is (4-pyrimidin-2-ylpiperazin-1-yl)-(2,3,4,9-tetrahydro-1H-carbazol-3-yl)methanone.
| Compound Name | (4-pyrimidin-2-ylpiperazin-1-yl)-(2,3,4,9-tetrahydro-1H-carbazol-3-yl)methanone |
|---|---|
| PubChem CID | 113203593 |
| Molecular Formula | C21H23N5O |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | (4-pyrimidin-2-ylpiperazin-1-yl)-(2,3,4,9-tetrahydro-1H-carbazol-3-yl)methanone |
| SMILES | O=C(C1CCc2[nH]c3ccccc3c2C1)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C21H23N5O/c27-20(25-10-12-26(13-11-25)21-22-8-3-9-23-21)15-6-7-19-17(14-15)16-4-1-2-5-18(16)24-19/h1-5,8-9,15,24H,6-7,10-14H2 |
| InChIKey | YGZOZSKQXBJDGX-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|