C23H24F3N5O3 — CID 154885497
(4-pyrimidin-2-ylpiperazin-1-yl)-(2,3,4,9-tetrahydro-1H-carbazol-1-yl)methanone;2,2,2-trifluoroacetic acid (PubChem CID 154885497) has the molecular formula C23H24F3N5O3 and a molecular weight of 475.47 g/mol. Its IUPAC name is (4-pyrimidin-2-ylpiperazin-1-yl)-(2,3,4,9-tetrahydro-1H-carbazol-1-yl)methanone;2,2,2-trifluoroacetic acid.
| Compound Name | (4-pyrimidin-2-ylpiperazin-1-yl)-(2,3,4,9-tetrahydro-1H-carbazol-1-yl)methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 154885497 |
| Molecular Formula | C23H24F3N5O3 |
| Molecular Weight | 475.47 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | (4-pyrimidin-2-ylpiperazin-1-yl)-(2,3,4,9-tetrahydro-1H-carbazol-1-yl)methanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(C1CCCc2c1[nH]c1ccccc21)N1CCN(c2ncccn2)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H23N5O.C2HF3O2/c27-20(25-11-13-26(14-12-25)21-22-9-4-10-23-21)17-7-3-6-16-15-5-1-2-8-18(15)24-19(16)17;3-2(4,5)1(6)7/h1-2,4-5,8-10,17,24H,3,6-7,11-14H2;(H,6,7) |
| InChIKey | XFLKZMSFLBPFEX-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.47 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |