C14H16N4O — CID 59626250
N-(diaminomethylidene)-2,3,4,9-tetrahydro-1H-carbazole-3-carboxamide (PubChem CID 59626250) has the molecular formula C14H16N4O and a molecular weight of 256.31 g/mol. Its IUPAC name is N-(diaminomethylidene)-2,3,4,9-tetrahydro-1H-carbazole-3-carboxamide.
| Compound Name | N-(diaminomethylidene)-2,3,4,9-tetrahydro-1H-carbazole-3-carboxamide |
|---|---|
| PubChem CID | 59626250 |
| Molecular Formula | C14H16N4O |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | N-(diaminomethylidene)-2,3,4,9-tetrahydro-1H-carbazole-3-carboxamide |
| SMILES | NC(N)=NC(=O)C1CCc2[nH]c3ccccc3c2C1 |
| InChI | InChI=1S/C14H16N4O/c15-14(16)18-13(19)8-5-6-12-10(7-8)9-3-1-2-4-11(9)17-12/h1-4,8,17H,5-7H2,(H4,15,16,18,19) |
| InChIKey | PNVXOPCTQRUHNT-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 97.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|