C22H27N3O2 — CID 26318760
(5S)-1-cyclopentyl-5-(1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl)piperidin-2-one (PubChem CID 26318760) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is (5S)-1-cyclopentyl-5-(1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl)piperidin-2-one.
| Compound Name | (5S)-1-cyclopentyl-5-(1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl)piperidin-2-one |
|---|---|
| PubChem CID | 26318760 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | (5S)-1-cyclopentyl-5-(1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl)piperidin-2-one |
| SMILES | O=C([C@H]1CCC(=O)N(C2CCCC2)C1)N1CCc2[nH]c3ccccc3c2C1 |
| InChI | InChI=1S/C22H27N3O2/c26-21-10-9-15(13-25(21)16-5-1-2-6-16)22(27)24-12-11-20-18(14-24)17-7-3-4-8-19(17)23-20/h3-4,7-8,15-16,23H,1-2,5-6,9-14H2/t15-/m0/s1 |
| InChIKey | OUOJKQUWBMGPFW-HNNXBMFYSA-N |
| XLogP | 3.23 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|