C23H23N3O2 — CID 96544197
(4R,5R)-1-methyl-5-phenyl-4-(1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl)pyrrolidin-2-one (PubChem CID 96544197) has the molecular formula C23H23N3O2 and a molecular weight of 373.46 g/mol. Its IUPAC name is (4R,5R)-1-methyl-5-phenyl-4-(1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl)pyrrolidin-2-one.
| Compound Name | (4R,5R)-1-methyl-5-phenyl-4-(1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 96544197 |
| Molecular Formula | C23H23N3O2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | (4R,5R)-1-methyl-5-phenyl-4-(1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl)pyrrolidin-2-one |
| SMILES | CN1C(=O)C[C@@H](C(=O)N2CCc3[nH]c4ccccc4c3C2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C23H23N3O2/c1-25-21(27)13-17(22(25)15-7-3-2-4-8-15)23(28)26-12-11-20-18(14-26)16-9-5-6-10-19(16)24-20/h2-10,17,22,24H,11-14H2,1H3/t17-,22+/m1/s1 |
| InChIKey | AANAQISJGPHYDG-VGSWGCGISA-N |
| XLogP | 3.27 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|