C21H18N2O3 — CID 42934976
3-(1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl)-3,4-dihydroisochromen-1-one (PubChem CID 42934976) has the molecular formula C21H18N2O3 and a molecular weight of 346.39 g/mol. Its IUPAC name is 3-(1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl)-3,4-dihydroisochromen-1-one.
| Compound Name | 3-(1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl)-3,4-dihydroisochromen-1-one |
|---|---|
| PubChem CID | 42934976 |
| Molecular Formula | C21H18N2O3 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 3-(1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl)-3,4-dihydroisochromen-1-one |
| SMILES | O=C1OC(C(=O)N2CCc3[nH]c4ccccc4c3C2)Cc2ccccc21 |
| InChI | InChI=1S/C21H18N2O3/c24-20(19-11-13-5-1-2-6-14(13)21(25)26-19)23-10-9-18-16(12-23)15-7-3-4-8-17(15)22-18/h1-8,19,22H,9-12H2 |
| InChIKey | YCWKGOXSERVYPK-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|