C19H16ClN3O2S — CID 97017480
[(5S)-3-(5-chlorothiophen-2-yl)-4,5-dihydro-1,2-oxazol-5-yl]-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone (PubChem CID 97017480) has the molecular formula C19H16ClN3O2S and a molecular weight of 385.88 g/mol. Its IUPAC name is [(5S)-3-(5-chlorothiophen-2-yl)-4,5-dihydro-1,2-oxazol-5-yl]-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone.
| Compound Name | [(5S)-3-(5-chlorothiophen-2-yl)-4,5-dihydro-1,2-oxazol-5-yl]-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone |
|---|---|
| PubChem CID | 97017480 |
| Molecular Formula | C19H16ClN3O2S |
| Molecular Weight | 385.88 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | [(5S)-3-(5-chlorothiophen-2-yl)-4,5-dihydro-1,2-oxazol-5-yl]-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone |
| SMILES | O=C([C@@H]1CC(c2ccc(Cl)s2)=NO1)N1CCc2[nH]c3ccccc3c2C1 |
| InChI | InChI=1S/C19H16ClN3O2S/c20-18-6-5-17(26-18)15-9-16(25-22-15)19(24)23-8-7-14-12(10-23)11-3-1-2-4-13(11)21-14/h1-6,16,21H,7-10H2/t16-/m0/s1 |
| InChIKey | MYIKRGBCLIHOBI-INIZCTEOSA-N |
| XLogP | 3.96 |
| TPSA | 57.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.88 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|