C21H16ClN3OS — CID 18209057
[2-(4-chlorophenyl)-1,3-thiazol-4-yl]-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone (PubChem CID 18209057) has the molecular formula C21H16ClN3OS and a molecular weight of 393.90 g/mol. Its IUPAC name is [2-(4-chlorophenyl)-1,3-thiazol-4-yl]-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone.
| Compound Name | [2-(4-chlorophenyl)-1,3-thiazol-4-yl]-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone |
|---|---|
| PubChem CID | 18209057 |
| Molecular Formula | C21H16ClN3OS |
| Molecular Weight | 393.90 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | [2-(4-chlorophenyl)-1,3-thiazol-4-yl]-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone |
| SMILES | O=C(c1csc(-c2ccc(Cl)cc2)n1)N1CCc2[nH]c3ccccc3c2C1 |
| InChI | InChI=1S/C21H16ClN3OS/c22-14-7-5-13(6-8-14)20-24-19(12-27-20)21(26)25-10-9-18-16(11-25)15-3-1-2-4-17(15)23-18/h1-8,12,23H,9-11H2 |
| InChIKey | GMXAJTRVCURKHC-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.90 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|