C23H24N2O2 — CID 102390639
methyl (2S,3aS,10aR)-1-benzyl-3,3a,4,9,10,10a-hexahydro-2H-pyrrolo[2,3-b]carbazole-2-carboxylate (PubChem CID 102390639) has the molecular formula C23H24N2O2 and a molecular weight of 360.46 g/mol. Its IUPAC name is methyl (2S,3aS,10aR)-1-benzyl-3,3a,4,9,10,10a-hexahydro-2H-pyrrolo[2,3-b]carbazole-2-carboxylate.
| Compound Name | methyl (2S,3aS,10aR)-1-benzyl-3,3a,4,9,10,10a-hexahydro-2H-pyrrolo[2,3-b]carbazole-2-carboxylate |
|---|---|
| PubChem CID | 102390639 |
| Molecular Formula | C23H24N2O2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | methyl (2S,3aS,10aR)-1-benzyl-3,3a,4,9,10,10a-hexahydro-2H-pyrrolo[2,3-b]carbazole-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@H]2Cc3c([nH]c4ccccc34)C[C@H]2N1Cc1ccccc1 |
| InChI | InChI=1S/C23H24N2O2/c1-27-23(26)22-12-16-11-18-17-9-5-6-10-19(17)24-20(18)13-21(16)25(22)14-15-7-3-2-4-8-15/h2-10,16,21-22,24H,11-14H2,1H3/t16-,21+,22-/m0/s1 |
| InChIKey | FCTLALHPSVVOIQ-USCONSEESA-N |
| XLogP | 3.70 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|