C23H27N3O3 — CID 15674755
(1S,3S)-2-benzyl-1-(2,2-dimethoxyethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxamide (PubChem CID 15674755) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is (1S,3S)-2-benzyl-1-(2,2-dimethoxyethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxamide.
| Compound Name | (1S,3S)-2-benzyl-1-(2,2-dimethoxyethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxamide |
|---|---|
| PubChem CID | 15674755 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | (1S,3S)-2-benzyl-1-(2,2-dimethoxyethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxamide |
| SMILES | COC(C[C@H]1c2[nH]c3ccccc3c2C[C@@H](C(N)=O)N1Cc1ccccc1)OC |
| InChI | InChI=1S/C23H27N3O3/c1-28-21(29-2)13-19-22-17(16-10-6-7-11-18(16)25-22)12-20(23(24)27)26(19)14-15-8-4-3-5-9-15/h3-11,19-21,25H,12-14H2,1-2H3,(H2,24,27)/t19-,20-/m0/s1 |
| InChIKey | CVCYVLBCADGZLL-PMACEKPBSA-N |
| XLogP | 3.13 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|