C26H27N3O4 — CID 15453576
tert-butyl (2S,8S)-5-benzyl-4,6-dioxo-5,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11,13,15-tetraene-8-carboxylate (PubChem CID 15453576) has the molecular formula C26H27N3O4 and a molecular weight of 445.52 g/mol. Its IUPAC name is tert-butyl (2S,8S)-5-benzyl-4,6-dioxo-5,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11,13,15-tetraene-8-carboxylate.
| Compound Name | tert-butyl (2S,8S)-5-benzyl-4,6-dioxo-5,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11,13,15-tetraene-8-carboxylate |
|---|---|
| PubChem CID | 15453576 |
| Molecular Formula | C26H27N3O4 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | tert-butyl (2S,8S)-5-benzyl-4,6-dioxo-5,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11,13,15-tetraene-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1Cc2c([nH]c3ccccc23)[C@@H]2CC(=O)N(Cc3ccccc3)C(=O)N12 |
| InChI | InChI=1S/C26H27N3O4/c1-26(2,3)33-24(31)21-13-18-17-11-7-8-12-19(17)27-23(18)20-14-22(30)28(25(32)29(20)21)15-16-9-5-4-6-10-16/h4-12,20-21,27H,13-15H2,1-3H3/t20-,21-/m0/s1 |
| InChIKey | UFVXIQNSHNOLFA-SFTDATJTSA-N |
| XLogP | 4.33 |
| TPSA | 82.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|