C25H28N2O2S2 — CID 15384909
methyl (1S,3R)-2-benzyl-1-(1,3-dithian-2-ylmethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate (PubChem CID 15384909) has the molecular formula C25H28N2O2S2 and a molecular weight of 452.65 g/mol. Its IUPAC name is methyl (1S,3R)-2-benzyl-1-(1,3-dithian-2-ylmethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate.
| Compound Name | methyl (1S,3R)-2-benzyl-1-(1,3-dithian-2-ylmethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 15384909 |
| Molecular Formula | C25H28N2O2S2 |
| Molecular Weight | 452.65 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | methyl (1S,3R)-2-benzyl-1-(1,3-dithian-2-ylmethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
| SMILES | COC(=O)[C@H]1Cc2c([nH]c3ccccc23)[C@H](CC2SCCCS2)N1Cc1ccccc1 |
| InChI | InChI=1S/C25H28N2O2S2/c1-29-25(28)22-14-19-18-10-5-6-11-20(18)26-24(19)21(15-23-30-12-7-13-31-23)27(22)16-17-8-3-2-4-9-17/h2-6,8-11,21-23,26H,7,12-16H2,1H3/t21-,22+/m0/s1 |
| InChIKey | KLVBZQSLZRSTSZ-FCHUYYIVSA-N |
| XLogP | 5.40 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.65 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|