C24H32N2O5 — CID 23241439
methyl (1S,3S)-1-[(5,5-dimethyl-1,3-dioxan-2-yl)methyl]-2-(3-oxobutyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate (PubChem CID 23241439) has the molecular formula C24H32N2O5 and a molecular weight of 428.53 g/mol. Its IUPAC name is methyl (1S,3S)-1-[(5,5-dimethyl-1,3-dioxan-2-yl)methyl]-2-(3-oxobutyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate.
| Compound Name | methyl (1S,3S)-1-[(5,5-dimethyl-1,3-dioxan-2-yl)methyl]-2-(3-oxobutyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 23241439 |
| Molecular Formula | C24H32N2O5 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | methyl (1S,3S)-1-[(5,5-dimethyl-1,3-dioxan-2-yl)methyl]-2-(3-oxobutyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
| SMILES | COC(=O)[C@@H]1Cc2c([nH]c3ccccc23)[C@H](CC2OCC(C)(C)CO2)N1CCC(C)=O |
| InChI | InChI=1S/C24H32N2O5/c1-15(27)9-10-26-19(12-21-30-13-24(2,3)14-31-21)22-17(11-20(26)23(28)29-4)16-7-5-6-8-18(16)25-22/h5-8,19-21,25H,9-14H2,1-4H3/t19-,20-/m0/s1 |
| InChIKey | WJPTVRULXXXRIH-PMACEKPBSA-N |
| XLogP | 3.38 |
| TPSA | 80.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|