C20H17BrN2O3 — CID 72711092
methyl (3S)-1-(5-bromofuran-2-yl)-2-prop-2-ynyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate (PubChem CID 72711092) has the molecular formula C20H17BrN2O3 and a molecular weight of 413.27 g/mol. Its IUPAC name is methyl (3S)-1-(5-bromofuran-2-yl)-2-prop-2-ynyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate.
| Compound Name | methyl (3S)-1-(5-bromofuran-2-yl)-2-prop-2-ynyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 72711092 |
| Molecular Formula | C20H17BrN2O3 |
| Molecular Weight | 413.27 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | methyl (3S)-1-(5-bromofuran-2-yl)-2-prop-2-ynyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
| SMILES | C#CCN1C(c2ccc(Br)o2)c2[nH]c3ccccc3c2C[C@H]1C(=O)OC |
| InChI | InChI=1S/C20H17BrN2O3/c1-3-10-23-15(20(24)25-2)11-13-12-6-4-5-7-14(12)22-18(13)19(23)16-8-9-17(21)26-16/h1,4-9,15,19,22H,10-11H2,2H3/t15-,19?/m0/s1 |
| InChIKey | RFHBXNLKJVVNCM-FUKCDUGKSA-N |
| XLogP | 3.65 |
| TPSA | 58.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.27 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|