C27H26N2O3Si — CID 176853158
methyl (1R,3R)-1-(4-ethynylphenyl)-2-(3-trimethylsilylprop-2-ynoyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate (PubChem CID 176853158) has the molecular formula C27H26N2O3Si and a molecular weight of 454.60 g/mol. Its IUPAC name is methyl (1R,3R)-1-(4-ethynylphenyl)-2-(3-trimethylsilylprop-2-ynoyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate.
| Compound Name | methyl (1R,3R)-1-(4-ethynylphenyl)-2-(3-trimethylsilylprop-2-ynoyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 176853158 |
| Molecular Formula | C27H26N2O3Si |
| Molecular Weight | 454.60 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | methyl (1R,3R)-1-(4-ethynylphenyl)-2-(3-trimethylsilylprop-2-ynoyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
| SMILES | C#Cc1ccc([C@@H]2c3[nH]c4ccccc4c3C[C@H](C(=O)OC)N2C(=O)C#C[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C27H26N2O3Si/c1-6-18-11-13-19(14-12-18)26-25-21(20-9-7-8-10-22(20)28-25)17-23(27(31)32-2)29(26)24(30)15-16-33(3,4)5/h1,7-14,23,26,28H,17H2,2-5H3/t23-,26-/m1/s1 |
| InChIKey | YUWXRQWVLVFFIY-ZEQKJWHPSA-N |
| XLogP | 4.05 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.60 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|