C27H31N3O3Si — CID 176853276
methyl (1R,3R)-1-[4-(dimethylamino)phenyl]-2-(3-trimethylsilylprop-2-ynoyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate (PubChem CID 176853276) has the molecular formula C27H31N3O3Si and a molecular weight of 473.65 g/mol. Its IUPAC name is methyl (1R,3R)-1-[4-(dimethylamino)phenyl]-2-(3-trimethylsilylprop-2-ynoyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate.
| Compound Name | methyl (1R,3R)-1-[4-(dimethylamino)phenyl]-2-(3-trimethylsilylprop-2-ynoyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 176853276 |
| Molecular Formula | C27H31N3O3Si |
| Molecular Weight | 473.65 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | methyl (1R,3R)-1-[4-(dimethylamino)phenyl]-2-(3-trimethylsilylprop-2-ynoyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
| SMILES | COC(=O)[C@H]1Cc2c([nH]c3ccccc23)[C@@H](c2ccc(N(C)C)cc2)N1C(=O)C#C[Si](C)(C)C |
| InChI | InChI=1S/C27H31N3O3Si/c1-29(2)19-13-11-18(12-14-19)26-25-21(20-9-7-8-10-22(20)28-25)17-23(27(32)33-3)30(26)24(31)15-16-34(4,5)6/h7-14,23,26,28H,17H2,1-6H3/t23-,26-/m1/s1 |
| InChIKey | UAZRMDPXZBRPSH-ZEQKJWHPSA-N |
| XLogP | 4.13 |
| TPSA | 65.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.65 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|