C33H35N3O4Si — CID 176853275
methyl 1-[4-(6-propan-2-yloxy-3-pyridinyl)phenyl]-2-(3-trimethylsilylprop-2-ynoyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate (PubChem CID 176853275) has the molecular formula C33H35N3O4Si and a molecular weight of 565.75 g/mol. Its IUPAC name is methyl 1-[4-(6-propan-2-yloxy-3-pyridinyl)phenyl]-2-(3-trimethylsilylprop-2-ynoyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate.
| Compound Name | methyl 1-[4-(6-propan-2-yloxy-3-pyridinyl)phenyl]-2-(3-trimethylsilylprop-2-ynoyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 176853275 |
| Molecular Formula | C33H35N3O4Si |
| Molecular Weight | 565.75 g/mol |
| Exact Mass | 565.24 |
| IUPAC Name | methyl 1-[4-(6-propan-2-yloxy-3-pyridinyl)phenyl]-2-(3-trimethylsilylprop-2-ynoyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
| SMILES | COC(=O)C1Cc2c([nH]c3ccccc23)C(c2ccc(-c3ccc(OC(C)C)nc3)cc2)N1C(=O)C#C[Si](C)(C)C |
| InChI | InChI=1S/C33H35N3O4Si/c1-21(2)40-29-16-15-24(20-34-29)22-11-13-23(14-12-22)32-31-26(25-9-7-8-10-27(25)35-31)19-28(33(38)39-3)36(32)30(37)17-18-41(4,5)6/h7-16,20-21,28,32,35H,19H2,1-6H3 |
| InChIKey | VRXODWCLZOQCCA-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 84.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.75 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|