C39H38N2O5Si — CID 176853248
methyl 6-(4-methoxyphenyl)-1-[4-(4-methoxyphenyl)phenyl]-2-(3-trimethylsilylprop-2-ynoyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate (PubChem CID 176853248) has the molecular formula C39H38N2O5Si and a molecular weight of 642.83 g/mol. Its IUPAC name is methyl 6-(4-methoxyphenyl)-1-[4-(4-methoxyphenyl)phenyl]-2-(3-trimethylsilylprop-2-ynoyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate.
| Compound Name | methyl 6-(4-methoxyphenyl)-1-[4-(4-methoxyphenyl)phenyl]-2-(3-trimethylsilylprop-2-ynoyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 176853248 |
| Molecular Formula | C39H38N2O5Si |
| Molecular Weight | 642.83 g/mol |
| Exact Mass | 642.25 |
| IUPAC Name | methyl 6-(4-methoxyphenyl)-1-[4-(4-methoxyphenyl)phenyl]-2-(3-trimethylsilylprop-2-ynoyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
| SMILES | COC(=O)C1Cc2c([nH]c3ccc(-c4ccc(OC)cc4)cc23)C(c2ccc(-c3ccc(OC)cc3)cc2)N1C(=O)C#C[Si](C)(C)C |
| InChI | InChI=1S/C39H38N2O5Si/c1-44-30-16-11-26(12-17-30)25-7-9-28(10-8-25)38-37-33(24-35(39(43)46-3)41(38)36(42)21-22-47(4,5)6)32-23-29(15-20-34(32)40-37)27-13-18-31(45-2)19-14-27/h7-20,23,35,38,40H,24H2,1-6H3 |
| InChIKey | ZNYQCWVIJGIDEB-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 80.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.83 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|