C33H41N9O3 — CID 46703599
methyl (1R,3S)-2-[4,6-bis(4-methylpiperazin-1-yl)-1,3,5-triazin-2-yl]-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate (PubChem CID 46703599) has the molecular formula C33H41N9O3 and a molecular weight of 611.75 g/mol. Its IUPAC name is methyl (1R,3S)-2-[4,6-bis(4-methylpiperazin-1-yl)-1,3,5-triazin-2-yl]-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate.
| Compound Name | methyl (1R,3S)-2-[4,6-bis(4-methylpiperazin-1-yl)-1,3,5-triazin-2-yl]-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 46703599 |
| Molecular Formula | C33H41N9O3 |
| Molecular Weight | 611.75 g/mol |
| Exact Mass | 611.33 |
| IUPAC Name | methyl (1R,3S)-2-[4,6-bis(4-methylpiperazin-1-yl)-1,3,5-triazin-2-yl]-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
| SMILES | COC(=O)[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2ccc(OC)cc2)N1c1nc(N2CCN(C)CC2)nc(N2CCN(C)CC2)n1 |
| InChI | InChI=1S/C33H41N9O3/c1-38-13-17-40(18-14-38)31-35-32(41-19-15-39(2)16-20-41)37-33(36-31)42-27(30(43)45-4)21-25-24-7-5-6-8-26(24)34-28(25)29(42)22-9-11-23(44-3)12-10-22/h5-12,27,29,34H,13-21H2,1-4H3/t27-,29+/m0/s1 |
| InChIKey | BLEKHENMFCIHBA-LMSSTIIKSA-N |
| XLogP | 2.56 |
| TPSA | 106.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.75 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|