C27H21N3O5 — CID 4966438
4-[10-(4-methoxyphenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]benzoic acid (PubChem CID 4966438) has the molecular formula C27H21N3O5 and a molecular weight of 467.48 g/mol. Its IUPAC name is 4-[10-(4-methoxyphenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]benzoic acid.
| Compound Name | 4-[10-(4-methoxyphenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]benzoic acid |
|---|---|
| PubChem CID | 4966438 |
| Molecular Formula | C27H21N3O5 |
| Molecular Weight | 467.48 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | 4-[10-(4-methoxyphenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]benzoic acid |
| SMILES | COc1ccc(C2c3[nH]c4ccccc4c3CC3C(=O)N(c4ccc(C(=O)O)cc4)C(=O)N32)cc1 |
| InChI | InChI=1S/C27H21N3O5/c1-35-18-12-8-15(9-13-18)24-23-20(19-4-2-3-5-21(19)28-23)14-22-25(31)29(27(34)30(22)24)17-10-6-16(7-11-17)26(32)33/h2-13,22,24,28H,14H2,1H3,(H,32,33) |
| InChIKey | KNQQDZSJTJASFL-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 102.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.48 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|