C27H21N3O3S — CID 6567706
methyl 4-[(10S,15R)-14-oxo-10-phenyl-12-sulfanylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]benzoate (PubChem CID 6567706) has the molecular formula C27H21N3O3S and a molecular weight of 467.55 g/mol. Its IUPAC name is methyl 4-[(10S,15R)-14-oxo-10-phenyl-12-sulfanylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]benzoate.
| Compound Name | methyl 4-[(10S,15R)-14-oxo-10-phenyl-12-sulfanylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]benzoate |
|---|---|
| PubChem CID | 6567706 |
| Molecular Formula | C27H21N3O3S |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | methyl 4-[(10S,15R)-14-oxo-10-phenyl-12-sulfanylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2C(=O)[C@H]3Cc4c([nH]c5ccccc45)[C@H](c4ccccc4)N3C2=S)cc1 |
| InChI | InChI=1S/C27H21N3O3S/c1-33-26(32)17-11-13-18(14-12-17)29-25(31)22-15-20-19-9-5-6-10-21(19)28-23(20)24(30(22)27(29)34)16-7-3-2-4-8-16/h2-14,22,24,28H,15H2,1H3/t22-,24+/m1/s1 |
| InChIKey | NTOSEONFBFZTIS-VWNXMTODSA-N |
| XLogP | 4.60 |
| TPSA | 65.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|