C35H30N4O5 — CID 95374341
4-[(10S,15S)-10-(4-methoxyphenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]-N-[(4-methoxyphenyl)methyl]benzamide (PubChem CID 95374341) has the molecular formula C35H30N4O5 and a molecular weight of 586.65 g/mol. Its IUPAC name is 4-[(10S,15S)-10-(4-methoxyphenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]-N-[(4-methoxyphenyl)methyl]benzamide.
| Compound Name | 4-[(10S,15S)-10-(4-methoxyphenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]-N-[(4-methoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 95374341 |
| Molecular Formula | C35H30N4O5 |
| Molecular Weight | 586.65 g/mol |
| Exact Mass | 586.22 |
| IUPAC Name | 4-[(10S,15S)-10-(4-methoxyphenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]-N-[(4-methoxyphenyl)methyl]benzamide |
| SMILES | COc1ccc(CNC(=O)c2ccc(N3C(=O)[C@@H]4Cc5c([nH]c6ccccc56)[C@H](c5ccc(OC)cc5)N4C3=O)cc2)cc1 |
| InChI | InChI=1S/C35H30N4O5/c1-43-25-15-7-21(8-16-25)20-36-33(40)23-9-13-24(14-10-23)38-34(41)30-19-28-27-5-3-4-6-29(27)37-31(28)32(39(30)35(38)42)22-11-17-26(44-2)18-12-22/h3-18,30,32,37H,19-20H2,1-2H3,(H,36,40)/t30-,32-/m0/s1 |
| InChIKey | SVAYERTXRFBHAV-CDZUIXILSA-N |
| XLogP | 5.60 |
| TPSA | 103.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.65 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|