C34H36N4O5 — CID 95374438
N-(3-butoxypropyl)-4-[(10S,15S)-10-(4-methoxyphenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]benzamide (PubChem CID 95374438) has the molecular formula C34H36N4O5 and a molecular weight of 580.68 g/mol. Its IUPAC name is N-(3-butoxypropyl)-4-[(10S,15S)-10-(4-methoxyphenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]benzamide.
| Compound Name | N-(3-butoxypropyl)-4-[(10S,15S)-10-(4-methoxyphenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]benzamide |
|---|---|
| PubChem CID | 95374438 |
| Molecular Formula | C34H36N4O5 |
| Molecular Weight | 580.68 g/mol |
| Exact Mass | 580.27 |
| IUPAC Name | N-(3-butoxypropyl)-4-[(10S,15S)-10-(4-methoxyphenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]benzamide |
| SMILES | CCCCOCCCNC(=O)c1ccc(N2C(=O)[C@@H]3Cc4c([nH]c5ccccc45)[C@H](c4ccc(OC)cc4)N3C2=O)cc1 |
| InChI | InChI=1S/C34H36N4O5/c1-3-4-19-43-20-7-18-35-32(39)23-10-14-24(15-11-23)37-33(40)29-21-27-26-8-5-6-9-28(26)36-30(27)31(38(29)34(37)41)22-12-16-25(42-2)17-13-22/h5-6,8-17,29,31,36H,3-4,7,18-21H2,1-2H3,(H,35,39)/t29-,31-/m0/s1 |
| InChIKey | NCBLKTIYZFGOJU-SMCANUKXSA-N |
| XLogP | 5.60 |
| TPSA | 103.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.68 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|