C33H33ClN4O4 — CID 95374229
N-(3-butoxypropyl)-2-[(10R,15S)-10-(3-chlorophenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]benzamide (PubChem CID 95374229) has the molecular formula C33H33ClN4O4 and a molecular weight of 585.10 g/mol. Its IUPAC name is N-(3-butoxypropyl)-2-[(10R,15S)-10-(3-chlorophenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]benzamide.
| Compound Name | N-(3-butoxypropyl)-2-[(10R,15S)-10-(3-chlorophenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]benzamide |
|---|---|
| PubChem CID | 95374229 |
| Molecular Formula | C33H33ClN4O4 |
| Molecular Weight | 585.10 g/mol |
| Exact Mass | 584.22 |
| IUPAC Name | N-(3-butoxypropyl)-2-[(10R,15S)-10-(3-chlorophenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]benzamide |
| SMILES | CCCCOCCCNC(=O)c1ccccc1N1C(=O)[C@@H]2Cc3c([nH]c4ccccc34)[C@@H](c3cccc(Cl)c3)N2C1=O |
| InChI | InChI=1S/C33H33ClN4O4/c1-2-3-17-42-18-9-16-35-31(39)24-13-5-7-15-27(24)38-32(40)28-20-25-23-12-4-6-14-26(23)36-29(25)30(37(28)33(38)41)21-10-8-11-22(34)19-21/h4-8,10-15,19,28,30,36H,2-3,9,16-18,20H2,1H3,(H,35,39)/t28-,30+/m0/s1 |
| InChIKey | NAUKOAGBQRDDKX-MFMCTBQISA-N |
| XLogP | 6.24 |
| TPSA | 94.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.10 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|