C30H27ClN4O3 — CID 93114564
N-[(2R)-butan-2-yl]-2-[(10S,15S)-10-(3-chlorophenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]benzamide (PubChem CID 93114564) has the molecular formula C30H27ClN4O3 and a molecular weight of 527.02 g/mol. Its IUPAC name is N-[(2R)-butan-2-yl]-2-[(10S,15S)-10-(3-chlorophenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]benzamide.
| Compound Name | N-[(2R)-butan-2-yl]-2-[(10S,15S)-10-(3-chlorophenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]benzamide |
|---|---|
| PubChem CID | 93114564 |
| Molecular Formula | C30H27ClN4O3 |
| Molecular Weight | 527.02 g/mol |
| Exact Mass | 526.18 |
| IUPAC Name | N-[(2R)-butan-2-yl]-2-[(10S,15S)-10-(3-chlorophenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]benzamide |
| SMILES | CC[C@@H](C)NC(=O)c1ccccc1N1C(=O)[C@@H]2Cc3c([nH]c4ccccc34)[C@H](c3cccc(Cl)c3)N2C1=O |
| InChI | InChI=1S/C30H27ClN4O3/c1-3-17(2)32-28(36)21-12-5-7-14-24(21)35-29(37)25-16-22-20-11-4-6-13-23(20)33-26(22)27(34(25)30(35)38)18-9-8-10-19(31)15-18/h4-15,17,25,27,33H,3,16H2,1-2H3,(H,32,36)/t17-,25+,27+/m1/s1 |
| InChIKey | LBMFOINYHLAWRH-ISCRSJHHSA-N |
| XLogP | 5.83 |
| TPSA | 85.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.02 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|