C30H23ClN4O7 — CID 95374293
(2S)-2-[[2-[(10R,15S)-10-(3-chlorophenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]benzoyl]amino]butanedioic acid (PubChem CID 95374293) has the molecular formula C30H23ClN4O7 and a molecular weight of 586.99 g/mol. Its IUPAC name is (2S)-2-[[2-[(10R,15S)-10-(3-chlorophenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]benzoyl]amino]butanedioic acid.
| Compound Name | (2S)-2-[[2-[(10R,15S)-10-(3-chlorophenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]benzoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 95374293 |
| Molecular Formula | C30H23ClN4O7 |
| Molecular Weight | 586.99 g/mol |
| Exact Mass | 586.13 |
| IUPAC Name | (2S)-2-[[2-[(10R,15S)-10-(3-chlorophenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]benzoyl]amino]butanedioic acid |
| SMILES | O=C(O)C[C@H](NC(=O)c1ccccc1N1C(=O)[C@@H]2Cc3c([nH]c4ccccc34)[C@@H](c3cccc(Cl)c3)N2C1=O)C(=O)O |
| InChI | InChI=1S/C30H23ClN4O7/c31-16-7-5-6-15(12-16)26-25-19(17-8-1-3-10-20(17)32-25)13-23-28(39)35(30(42)34(23)26)22-11-4-2-9-18(22)27(38)33-21(29(40)41)14-24(36)37/h1-12,21,23,26,32H,13-14H2,(H,33,38)(H,36,37)(H,40,41)/t21-,23-,26+/m0/s1 |
| InChIKey | FNXNDWCDMQMYDX-RZPFDVGOSA-N |
| XLogP | 3.96 |
| TPSA | 160.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.99 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|