C32H28N4O7 — CID 73256082
2-[[2-[10-(4-methylphenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]benzoyl]amino]pentanedioic acid (PubChem CID 73256082) has the molecular formula C32H28N4O7 and a molecular weight of 580.60 g/mol. Its IUPAC name is 2-[[2-[10-(4-methylphenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]benzoyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-[10-(4-methylphenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]benzoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 73256082 |
| Molecular Formula | C32H28N4O7 |
| Molecular Weight | 580.60 g/mol |
| Exact Mass | 580.20 |
| IUPAC Name | 2-[[2-[10-(4-methylphenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]benzoyl]amino]pentanedioic acid |
| SMILES | Cc1ccc(C2c3[nH]c4ccccc4c3CC3C(=O)N(c4ccccc4C(=O)NC(CCC(=O)O)C(=O)O)C(=O)N32)cc1 |
| InChI | InChI=1S/C32H28N4O7/c1-17-10-12-18(13-11-17)28-27-21(19-6-2-4-8-22(19)33-27)16-25-30(40)36(32(43)35(25)28)24-9-5-3-7-20(24)29(39)34-23(31(41)42)14-15-26(37)38/h2-13,23,25,28,33H,14-16H2,1H3,(H,34,39)(H,37,38)(H,41,42) |
| InChIKey | HWYKMNYSQUSHGN-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 160.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.60 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|