C34H35FN4O3 — CID 73256215
2-[10-(4-fluorophenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]-N-(6-methylheptan-2-yl)benzamide (PubChem CID 73256215) has the molecular formula C34H35FN4O3 and a molecular weight of 566.68 g/mol. Its IUPAC name is 2-[10-(4-fluorophenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]-N-(6-methylheptan-2-yl)benzamide.
| Compound Name | 2-[10-(4-fluorophenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]-N-(6-methylheptan-2-yl)benzamide |
|---|---|
| PubChem CID | 73256215 |
| Molecular Formula | C34H35FN4O3 |
| Molecular Weight | 566.68 g/mol |
| Exact Mass | 566.27 |
| IUPAC Name | 2-[10-(4-fluorophenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]-N-(6-methylheptan-2-yl)benzamide |
| SMILES | CC(C)CCCC(C)NC(=O)c1ccccc1N1C(=O)C2Cc3c([nH]c4ccccc34)C(c3ccc(F)cc3)N2C1=O |
| InChI | InChI=1S/C34H35FN4O3/c1-20(2)9-8-10-21(3)36-32(40)25-12-5-7-14-28(25)39-33(41)29-19-26-24-11-4-6-13-27(24)37-30(26)31(38(29)34(39)42)22-15-17-23(35)18-16-22/h4-7,11-18,20-21,29,31,37H,8-10,19H2,1-3H3,(H,36,40) |
| InChIKey | UHIVCBYOSUWBFO-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 85.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.68 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|