C37H34N4O4 — CID 95374166
2-[(10R,15S)-10-(4-methoxyphenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]-N-[(2S)-4-phenylbutan-2-yl]benzamide (PubChem CID 95374166) has the molecular formula C37H34N4O4 and a molecular weight of 598.70 g/mol. Its IUPAC name is 2-[(10R,15S)-10-(4-methoxyphenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]-N-[(2S)-4-phenylbutan-2-yl]benzamide.
| Compound Name | 2-[(10R,15S)-10-(4-methoxyphenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]-N-[(2S)-4-phenylbutan-2-yl]benzamide |
|---|---|
| PubChem CID | 95374166 |
| Molecular Formula | C37H34N4O4 |
| Molecular Weight | 598.70 g/mol |
| Exact Mass | 598.26 |
| IUPAC Name | 2-[(10R,15S)-10-(4-methoxyphenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]-N-[(2S)-4-phenylbutan-2-yl]benzamide |
| SMILES | COc1ccc([C@@H]2c3[nH]c4ccccc4c3C[C@H]3C(=O)N(c4ccccc4C(=O)N[C@@H](C)CCc4ccccc4)C(=O)N23)cc1 |
| InChI | InChI=1S/C37H34N4O4/c1-23(16-17-24-10-4-3-5-11-24)38-35(42)28-13-7-9-15-31(28)41-36(43)32-22-29-27-12-6-8-14-30(27)39-33(29)34(40(32)37(41)44)25-18-20-26(45-2)21-19-25/h3-15,18-21,23,32,34,39H,16-17,22H2,1-2H3,(H,38,42)/t23-,32-,34+/m0/s1 |
| InChIKey | QTSFWSGMTXRFNS-XMGPFZAUSA-N |
| XLogP | 6.41 |
| TPSA | 94.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.70 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|