C33H32N4O6 — CID 95374303
(2S)-2-[[2-[(10S,15S)-10-(4-methoxyphenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]benzoyl]amino]-4-methylpentanoic acid (PubChem CID 95374303) has the molecular formula C33H32N4O6 and a molecular weight of 580.64 g/mol. Its IUPAC name is (2S)-2-[[2-[(10S,15S)-10-(4-methoxyphenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]benzoyl]amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[2-[(10S,15S)-10-(4-methoxyphenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]benzoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 95374303 |
| Molecular Formula | C33H32N4O6 |
| Molecular Weight | 580.64 g/mol |
| Exact Mass | 580.23 |
| IUPAC Name | (2S)-2-[[2-[(10S,15S)-10-(4-methoxyphenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]benzoyl]amino]-4-methylpentanoic acid |
| SMILES | COc1ccc([C@H]2c3[nH]c4ccccc4c3C[C@H]3C(=O)N(c4ccccc4C(=O)N[C@@H](CC(C)C)C(=O)O)C(=O)N23)cc1 |
| InChI | InChI=1S/C33H32N4O6/c1-18(2)16-25(32(40)41)35-30(38)22-9-5-7-11-26(22)37-31(39)27-17-23-21-8-4-6-10-24(21)34-28(23)29(36(27)33(37)42)19-12-14-20(43-3)15-13-19/h4-15,18,25,27,29,34H,16-17H2,1-3H3,(H,35,38)(H,40,41)/t25-,27-,29-/m0/s1 |
| InChIKey | FFLHZMDDPFCXPO-RWPDHJIBSA-N |
| XLogP | 4.89 |
| TPSA | 132.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.64 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|