C30H26N4O6 — CID 95373081
(2S)-2-[[2-[(10R,15S)-10-(3-methoxyphenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]benzoyl]amino]propanoic acid (PubChem CID 95373081) has the molecular formula C30H26N4O6 and a molecular weight of 538.56 g/mol. Its IUPAC name is (2S)-2-[[2-[(10R,15S)-10-(3-methoxyphenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]benzoyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[2-[(10R,15S)-10-(3-methoxyphenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 95373081 |
| Molecular Formula | C30H26N4O6 |
| Molecular Weight | 538.56 g/mol |
| Exact Mass | 538.19 |
| IUPAC Name | (2S)-2-[[2-[(10R,15S)-10-(3-methoxyphenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]benzoyl]amino]propanoic acid |
| SMILES | COc1cccc([C@@H]2c3[nH]c4ccccc4c3C[C@H]3C(=O)N(c4ccccc4C(=O)N[C@@H](C)C(=O)O)C(=O)N23)c1 |
| InChI | InChI=1S/C30H26N4O6/c1-16(29(37)38)31-27(35)20-11-4-6-13-23(20)34-28(36)24-15-21-19-10-3-5-12-22(19)32-25(21)26(33(24)30(34)39)17-8-7-9-18(14-17)40-2/h3-14,16,24,26,32H,15H2,1-2H3,(H,31,35)(H,37,38)/t16-,24-,26+/m0/s1 |
| InChIKey | PVTIRADOJZIYSP-JRWZBITLSA-N |
| XLogP | 3.86 |
| TPSA | 132.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.56 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|