C32H30N4O5 — CID 95374276
2-[(10R,15S)-10-(3-methoxyphenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]-N-[[(2R)-oxolan-2-yl]methyl]benzamide (PubChem CID 95374276) has the molecular formula C32H30N4O5 and a molecular weight of 550.62 g/mol. Its IUPAC name is 2-[(10R,15S)-10-(3-methoxyphenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]-N-[[(2R)-oxolan-2-yl]methyl]benzamide.
| Compound Name | 2-[(10R,15S)-10-(3-methoxyphenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]-N-[[(2R)-oxolan-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 95374276 |
| Molecular Formula | C32H30N4O5 |
| Molecular Weight | 550.62 g/mol |
| Exact Mass | 550.22 |
| IUPAC Name | 2-[(10R,15S)-10-(3-methoxyphenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]-N-[[(2R)-oxolan-2-yl]methyl]benzamide |
| SMILES | COc1cccc([C@@H]2c3[nH]c4ccccc4c3C[C@H]3C(=O)N(c4ccccc4C(=O)NC[C@H]4CCCO4)C(=O)N23)c1 |
| InChI | InChI=1S/C32H30N4O5/c1-40-20-9-6-8-19(16-20)29-28-24(22-11-2-4-13-25(22)34-28)17-27-31(38)36(32(39)35(27)29)26-14-5-3-12-23(26)30(37)33-18-21-10-7-15-41-21/h2-6,8-9,11-14,16,21,27,29,34H,7,10,15,17-18H2,1H3,(H,33,37)/t21-,27+,29-/m1/s1 |
| InChIKey | KTUQHZGGWLWRQB-WTILKEDBSA-N |
| XLogP | 4.57 |
| TPSA | 103.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.62 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|