C36H32N4O3 — CID 73256298
2-(12,14-dioxo-10-phenyl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl)-N-(4-phenylbutan-2-yl)benzamide (PubChem CID 73256298) has the molecular formula C36H32N4O3 and a molecular weight of 568.68 g/mol. Its IUPAC name is 2-(12,14-dioxo-10-phenyl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl)-N-(4-phenylbutan-2-yl)benzamide.
| Compound Name | 2-(12,14-dioxo-10-phenyl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl)-N-(4-phenylbutan-2-yl)benzamide |
|---|---|
| PubChem CID | 73256298 |
| Molecular Formula | C36H32N4O3 |
| Molecular Weight | 568.68 g/mol |
| Exact Mass | 568.25 |
| IUPAC Name | 2-(12,14-dioxo-10-phenyl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl)-N-(4-phenylbutan-2-yl)benzamide |
| SMILES | CC(CCc1ccccc1)NC(=O)c1ccccc1N1C(=O)C2Cc3c([nH]c4ccccc34)C(c3ccccc3)N2C1=O |
| InChI | InChI=1S/C36H32N4O3/c1-23(20-21-24-12-4-2-5-13-24)37-34(41)27-17-9-11-19-30(27)40-35(42)31-22-28-26-16-8-10-18-29(26)38-32(28)33(39(31)36(40)43)25-14-6-3-7-15-25/h2-19,23,31,33,38H,20-22H2,1H3,(H,37,41) |
| InChIKey | AQHSSWHPMVUTCX-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 85.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.68 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|