C31H30N4O3 — CID 4964499
2-(12,14-dioxo-10-phenyl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl)-N-(3-methylbutyl)benzamide (PubChem CID 4964499) has the molecular formula C31H30N4O3 and a molecular weight of 506.61 g/mol. Its IUPAC name is 2-(12,14-dioxo-10-phenyl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl)-N-(3-methylbutyl)benzamide.
| Compound Name | 2-(12,14-dioxo-10-phenyl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl)-N-(3-methylbutyl)benzamide |
|---|---|
| PubChem CID | 4964499 |
| Molecular Formula | C31H30N4O3 |
| Molecular Weight | 506.61 g/mol |
| Exact Mass | 506.23 |
| IUPAC Name | 2-(12,14-dioxo-10-phenyl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl)-N-(3-methylbutyl)benzamide |
| SMILES | CC(C)CCNC(=O)c1ccccc1N1C(=O)C2Cc3c([nH]c4ccccc34)C(c3ccccc3)N2C1=O |
| InChI | InChI=1S/C31H30N4O3/c1-19(2)16-17-32-29(36)22-13-7-9-15-25(22)35-30(37)26-18-23-21-12-6-8-14-24(21)33-27(23)28(34(26)31(35)38)20-10-4-3-5-11-20/h3-15,19,26,28,33H,16-18H2,1-2H3,(H,32,36) |
| InChIKey | QQQQOZUUMIBPNM-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 85.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.61 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|