C29H25FN4O4 — CID 40825593
2-[(10S,15S)-10-(4-fluorophenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]-N-(2-methoxyethyl)benzamide (PubChem CID 40825593) has the molecular formula C29H25FN4O4 and a molecular weight of 512.54 g/mol. Its IUPAC name is 2-[(10S,15S)-10-(4-fluorophenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]-N-(2-methoxyethyl)benzamide.
| Compound Name | 2-[(10S,15S)-10-(4-fluorophenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 40825593 |
| Molecular Formula | C29H25FN4O4 |
| Molecular Weight | 512.54 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | 2-[(10S,15S)-10-(4-fluorophenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]-N-(2-methoxyethyl)benzamide |
| SMILES | COCCNC(=O)c1ccccc1N1C(=O)[C@@H]2Cc3c([nH]c4ccccc34)[C@H](c3ccc(F)cc3)N2C1=O |
| InChI | InChI=1S/C29H25FN4O4/c1-38-15-14-31-27(35)20-7-3-5-9-23(20)34-28(36)24-16-21-19-6-2-4-8-22(19)32-25(21)26(33(24)29(34)37)17-10-12-18(30)13-11-17/h2-13,24,26,32H,14-16H2,1H3,(H,31,35)/t24-,26-/m0/s1 |
| InChIKey | VJULYHOPFXCMAY-AHWVRZQESA-N |
| XLogP | 4.17 |
| TPSA | 94.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.54 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|