C32H32N4O3 — CID 40825844
2-[(10S,15S)-12,14-dioxo-10-(4-propan-2-ylphenyl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]-N-propan-2-ylbenzamide (PubChem CID 40825844) has the molecular formula C32H32N4O3 and a molecular weight of 520.63 g/mol. Its IUPAC name is 2-[(10S,15S)-12,14-dioxo-10-(4-propan-2-ylphenyl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]-N-propan-2-ylbenzamide.
| Compound Name | 2-[(10S,15S)-12,14-dioxo-10-(4-propan-2-ylphenyl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 40825844 |
| Molecular Formula | C32H32N4O3 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.25 |
| IUPAC Name | 2-[(10S,15S)-12,14-dioxo-10-(4-propan-2-ylphenyl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]-N-propan-2-ylbenzamide |
| SMILES | CC(C)NC(=O)c1ccccc1N1C(=O)[C@@H]2Cc3c([nH]c4ccccc34)[C@H](c3ccc(C(C)C)cc3)N2C1=O |
| InChI | InChI=1S/C32H32N4O3/c1-18(2)20-13-15-21(16-14-20)29-28-24(22-9-5-7-11-25(22)34-28)17-27-31(38)36(32(39)35(27)29)26-12-8-6-10-23(26)30(37)33-19(3)4/h5-16,18-19,27,29,34H,17H2,1-4H3,(H,33,37)/t27-,29-/m0/s1 |
| InChIKey | SOOKEHKHXDIASM-YTMVLYRLSA-N |
| XLogP | 5.91 |
| TPSA | 85.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|