C29H34N4O3 — CID 4964607
2-(10-methyl-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl)-N-(6-methylheptan-2-yl)benzamide (PubChem CID 4964607) has the molecular formula C29H34N4O3 and a molecular weight of 486.62 g/mol. Its IUPAC name is 2-(10-methyl-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl)-N-(6-methylheptan-2-yl)benzamide.
| Compound Name | 2-(10-methyl-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl)-N-(6-methylheptan-2-yl)benzamide |
|---|---|
| PubChem CID | 4964607 |
| Molecular Formula | C29H34N4O3 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | 2-(10-methyl-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl)-N-(6-methylheptan-2-yl)benzamide |
| SMILES | CC(C)CCCC(C)NC(=O)c1ccccc1N1C(=O)C2Cc3c([nH]c4ccccc34)C(C)N2C1=O |
| InChI | InChI=1S/C29H34N4O3/c1-17(2)10-9-11-18(3)30-27(34)21-13-6-8-15-24(21)33-28(35)25-16-22-20-12-5-7-14-23(20)31-26(22)19(4)32(25)29(33)36/h5-8,12-15,17-19,25,31H,9-11,16H2,1-4H3,(H,30,34) |
| InChIKey | KDNMPUYOFPEXIU-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 85.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|