C20H17N3O2S — CID 25061294
10-(hydroxymethyl)-13-phenyl-12-sulfanylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-14-one (PubChem CID 25061294) has the molecular formula C20H17N3O2S and a molecular weight of 363.44 g/mol. Its IUPAC name is 10-(hydroxymethyl)-13-phenyl-12-sulfanylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-14-one.
| Compound Name | 10-(hydroxymethyl)-13-phenyl-12-sulfanylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-14-one |
|---|---|
| PubChem CID | 25061294 |
| Molecular Formula | C20H17N3O2S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | 10-(hydroxymethyl)-13-phenyl-12-sulfanylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-14-one |
| SMILES | O=C1C2Cc3c([nH]c4ccccc34)C(CO)N2C(=S)N1c1ccccc1 |
| InChI | InChI=1S/C20H17N3O2S/c24-11-17-18-14(13-8-4-5-9-15(13)21-18)10-16-19(25)22(20(26)23(16)17)12-6-2-1-3-7-12/h1-9,16-17,21,24H,10-11H2 |
| InChIKey | QTNJXWMYSNMNJT-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 59.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|