C21H19N3OS — CID 101367999
(15S)-10,10-dimethyl-13-phenyl-12-sulfanylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-14-one (PubChem CID 101367999) has the molecular formula C21H19N3OS and a molecular weight of 361.47 g/mol. Its IUPAC name is (15S)-10,10-dimethyl-13-phenyl-12-sulfanylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-14-one.
| Compound Name | (15S)-10,10-dimethyl-13-phenyl-12-sulfanylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-14-one |
|---|---|
| PubChem CID | 101367999 |
| Molecular Formula | C21H19N3OS |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | (15S)-10,10-dimethyl-13-phenyl-12-sulfanylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-14-one |
| SMILES | CC1(C)c2[nH]c3ccccc3c2C[C@H]2C(=O)N(c3ccccc3)C(=S)N21 |
| InChI | InChI=1S/C21H19N3OS/c1-21(2)18-15(14-10-6-7-11-16(14)22-18)12-17-19(25)23(20(26)24(17)21)13-8-4-3-5-9-13/h3-11,17,22H,12H2,1-2H3/t17-/m0/s1 |
| InChIKey | FXOWQYFLLVTFQP-KRWDZBQOSA-N |
| XLogP | 3.96 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|