C25H24N4O4 — CID 3792530
methyl 4-[(2,2-dimethyl-4,7-dioxo-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraen-6-yl)iminomethyl]benzoate (PubChem CID 3792530) has the molecular formula C25H24N4O4 and a molecular weight of 444.49 g/mol. Its IUPAC name is methyl 4-[(2,2-dimethyl-4,7-dioxo-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraen-6-yl)iminomethyl]benzoate.
| Compound Name | methyl 4-[(2,2-dimethyl-4,7-dioxo-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraen-6-yl)iminomethyl]benzoate |
|---|---|
| PubChem CID | 3792530 |
| Molecular Formula | C25H24N4O4 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | methyl 4-[(2,2-dimethyl-4,7-dioxo-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraen-6-yl)iminomethyl]benzoate |
| SMILES | COC(=O)c1ccc(C=NN2CC(=O)N3C(Cc4c([nH]c5ccccc45)C3(C)C)C2=O)cc1 |
| InChI | InChI=1S/C25H24N4O4/c1-25(2)22-18(17-6-4-5-7-19(17)27-22)12-20-23(31)28(14-21(30)29(20)25)26-13-15-8-10-16(11-9-15)24(32)33-3/h4-11,13,20,27H,12,14H2,1-3H3 |
| InChIKey | LAOWNDIXNLNKEC-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 95.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|