C31H30N4O4 — CID 4838672
N-butan-2-yl-4-[10-(3-methoxyphenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]benzamide (PubChem CID 4838672) has the molecular formula C31H30N4O4 and a molecular weight of 522.61 g/mol. Its IUPAC name is N-butan-2-yl-4-[10-(3-methoxyphenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]benzamide.
| Compound Name | N-butan-2-yl-4-[10-(3-methoxyphenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]benzamide |
|---|---|
| PubChem CID | 4838672 |
| Molecular Formula | C31H30N4O4 |
| Molecular Weight | 522.61 g/mol |
| Exact Mass | 522.23 |
| IUPAC Name | N-butan-2-yl-4-[10-(3-methoxyphenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]benzamide |
| SMILES | CCC(C)NC(=O)c1ccc(N2C(=O)C3Cc4c([nH]c5ccccc45)C(c4cccc(OC)c4)N3C2=O)cc1 |
| InChI | InChI=1S/C31H30N4O4/c1-4-18(2)32-29(36)19-12-14-21(15-13-19)34-30(37)26-17-24-23-10-5-6-11-25(23)33-27(24)28(35(26)31(34)38)20-8-7-9-22(16-20)39-3/h5-16,18,26,28,33H,4,17H2,1-3H3,(H,32,36) |
| InChIKey | JVHPLFNEWFWBEH-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 94.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.61 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|