C29H29N3O4 — CID 10299655
methyl 2-[(1S,3S)-3-(benzylcarbamoyl)-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]acetate (PubChem CID 10299655) has the molecular formula C29H29N3O4 and a molecular weight of 483.57 g/mol. Its IUPAC name is methyl 2-[(1S,3S)-3-(benzylcarbamoyl)-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]acetate.
| Compound Name | methyl 2-[(1S,3S)-3-(benzylcarbamoyl)-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]acetate |
|---|---|
| PubChem CID | 10299655 |
| Molecular Formula | C29H29N3O4 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | methyl 2-[(1S,3S)-3-(benzylcarbamoyl)-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]acetate |
| SMILES | COC(=O)CN1[C@@H](c2ccc(OC)cc2)c2[nH]c3ccccc3c2C[C@H]1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C29H29N3O4/c1-35-21-14-12-20(13-15-21)28-27-23(22-10-6-7-11-24(22)31-27)16-25(32(28)18-26(33)36-2)29(34)30-17-19-8-4-3-5-9-19/h3-15,25,28,31H,16-18H2,1-2H3,(H,30,34)/t25-,28-/m0/s1 |
| InChIKey | KOSIQNCCPWCXAI-LSYYVWMOSA-N |
| XLogP | 3.98 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|